C26H18BrNO6 — CID 4231712
9-bromo-2-hydroxy-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4231712) has the molecular formula C26H18BrNO6 and a molecular weight of 520.34 g/mol. Its IUPAC name is 9-bromo-2-hydroxy-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-2-hydroxy-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4231712 |
| Molecular Formula | C26H18BrNO6 |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | 9-bromo-2-hydroxy-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1C(c1ccc(O)c3ccccc13)C1=CCC3C(=O)N(O)C(=O)C3C1C2 |
| InChI | InChI=1S/C26H18BrNO6/c27-18-10-20(30)23-17(24(18)31)9-16-14(5-6-15-22(16)26(33)28(34)25(15)32)21(23)13-7-8-19(29)12-4-2-1-3-11(12)13/h1-5,7-8,10,15-16,21-22,29,34H,6,9H2 |
| InChIKey | HWFHJLNGQCDXAN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|