C28H20BrNO7 — CID 3465438
methyl 9-bromo-6-(1-hydroxynaphthalen-2-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 3465438) has the molecular formula C28H20BrNO7 and a molecular weight of 562.37 g/mol. Its IUPAC name is methyl 9-bromo-6-(1-hydroxynaphthalen-2-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl 9-bromo-6-(1-hydroxynaphthalen-2-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 3465438 |
| Molecular Formula | C28H20BrNO7 |
| Molecular Weight | 562.37 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | methyl 9-bromo-6-(1-hydroxynaphthalen-2-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(c4ccc5ccccc5c4O)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C28H20BrNO7/c1-37-28(36)30-26(34)16-9-8-14-17(22(16)27(30)35)10-18-23(20(31)11-19(29)25(18)33)21(14)15-7-6-12-4-2-3-5-13(12)24(15)32/h2-8,11,16-17,21-22,32H,9-10H2,1H3 |
| InChIKey | UVHGTHDRZLESRP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|