C26H23NO8 — CID 6664987
methyl (3aS,6R,11aS,11bR)-6-(2-hydroxy-4-methoxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 6664987) has the molecular formula C26H23NO8 and a molecular weight of 477.47 g/mol. Its IUPAC name is methyl (3aS,6R,11aS,11bR)-6-(2-hydroxy-4-methoxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6R,11aS,11bR)-6-(2-hydroxy-4-methoxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6664987 |
| Molecular Formula | C26H23NO8 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | methyl (3aS,6R,11aS,11bR)-6-(2-hydroxy-4-methoxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H](c4ccc(OC)cc4O)C4=C(C[C@H]32)C(=O)C=C(C)C4=O)C1=O |
| InChI | InChI=1S/C26H23NO8/c1-11-8-18(28)17-10-16-13(6-7-15-21(16)25(32)27(24(15)31)26(33)35-3)20(22(17)23(11)30)14-5-4-12(34-2)9-19(14)29/h4-6,8-9,15-16,20-21,29H,7,10H2,1-3H3/t15-,16+,20+,21-/m0/s1 |
| InChIKey | UQDWUAADXMIECE-HDIOYNLWSA-N |
| XLogP | 2.60 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|