C30H24N2O8 — CID 5103376
6-(2-hydroxy-4-methoxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5103376) has the molecular formula C30H24N2O8 and a molecular weight of 540.53 g/mol. Its IUPAC name is 6-(2-hydroxy-4-methoxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(2-hydroxy-4-methoxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5103376 |
| Molecular Formula | C30H24N2O8 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 6-(2-hydroxy-4-methoxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)C4C3CC3=C2C(=O)C(C)=CC3=O)c(O)c1 |
| InChI | InChI=1S/C30H24N2O8/c1-14-11-23(33)22-13-21-18(25(27(22)28(14)35)19-8-7-17(40-2)12-24(19)34)9-10-20-26(21)30(37)31(29(20)36)15-3-5-16(6-4-15)32(38)39/h3-9,11-12,20-21,25-26,34H,10,13H2,1-2H3 |
| InChIKey | JFNPCOMCFNUYAN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|