C30H23BrN2O9 — CID 6662000
(3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-4,6-dimethoxyphenyl)-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6662000) has the molecular formula C30H23BrN2O9 and a molecular weight of 635.42 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-4,6-dimethoxyphenyl)-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-4,6-dimethoxyphenyl)-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6662000 |
| Molecular Formula | C30H23BrN2O9 |
| Molecular Weight | 635.42 g/mol |
| Exact Mass | 634.06 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-4,6-dimethoxyphenyl)-2-(4-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)c([C@H]2C3=CC[C@@H]4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C=C(Br)C3=O)c(OC)c1 |
| InChI | InChI=1S/C30H23BrN2O9/c1-41-15-9-21(34)27(23(10-15)42-2)26-16-7-8-17-24(18(16)11-19-25(26)22(35)12-20(31)28(19)36)30(38)32(29(17)37)13-3-5-14(6-4-13)33(39)40/h3-7,9-10,12,17-18,24,26,34H,8,11H2,1-2H3/t17-,18+,24-,26-/m0/s1 |
| InChIKey | JBZQKXKURFQYRL-PIYGHUCRSA-N |
| XLogP | 4.28 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|