C35H34N2O8 — CID 4049740
6-(2-hydroxy-4,6-dimethoxyphenyl)-9-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4049740) has the molecular formula C35H34N2O8 and a molecular weight of 610.66 g/mol. Its IUPAC name is 6-(2-hydroxy-4,6-dimethoxyphenyl)-9-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(2-hydroxy-4,6-dimethoxyphenyl)-9-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4049740 |
| Molecular Formula | C35H34N2O8 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 6-(2-hydroxy-4,6-dimethoxyphenyl)-9-methyl-2-(4-morpholin-4-ylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)c(C2C3=CCC4C(=O)N(c5ccc(N6CCOCC6)cc5)C(=O)C4C3CC3=C2C(=O)C=C(C)C3=O)c(OC)c1 |
| InChI | InChI=1S/C35H34N2O8/c1-18-14-26(38)30-25(33(18)40)17-24-22(31(30)32-27(39)15-21(43-2)16-28(32)44-3)8-9-23-29(24)35(42)37(34(23)41)20-6-4-19(5-7-20)36-10-12-45-13-11-36/h4-8,14-16,23-24,29,31,39H,9-13,17H2,1-3H3 |
| InChIKey | ZAOFXXXTHRYUTR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|