C41H37NO9 — CID 5079918
2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-4,6-dimethoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5079918) has the molecular formula C41H37NO9 and a molecular weight of 687.75 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-4,6-dimethoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-4,6-dimethoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5079918 |
| Molecular Formula | C41H37NO9 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | 2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-4,6-dimethoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(OC)c(C=Cc2ccc(N3C(=O)C4CC=C5C(c6c(O)cc(OC)cc6OC)C6=C(CC5C4C3=O)C(=O)C(C)=CC6=O)cc2)c1 |
| InChI | InChI=1S/C41H37NO9/c1-21-16-31(43)36-30(39(21)45)20-29-27(37(36)38-32(44)18-26(49-3)19-34(38)51-5)13-14-28-35(29)41(47)42(40(28)46)24-10-7-22(8-11-24)6-9-23-17-25(48-2)12-15-33(23)50-4/h6-13,15-19,28-29,35,37,44H,14,20H2,1-5H3 |
| InChIKey | CHVABSATIPAQEW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|