C40H34BrNO9 — CID 3578165
9-bromo-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3578165) has the molecular formula C40H34BrNO9 and a molecular weight of 752.61 g/mol. Its IUPAC name is 9-bromo-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3578165 |
| Molecular Formula | C40H34BrNO9 |
| Molecular Weight | 752.61 g/mol |
| Exact Mass | 751.14 |
| IUPAC Name | 9-bromo-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(OC)c(C=Cc2ccc(N3C(=O)C4CC=C5C(c6c(OC)cc(O)cc6OC)C6=C(CC5C4C3=O)C(=O)C(Br)=CC6=O)cc2)c1 |
| InChI | InChI=1S/C40H34BrNO9/c1-48-24-11-14-31(49-2)21(15-24)8-5-20-6-9-22(10-7-20)42-39(46)26-13-12-25-27(34(26)40(42)47)18-28-35(30(44)19-29(41)38(28)45)36(25)37-32(50-3)16-23(43)17-33(37)51-4/h5-12,14-17,19,26-27,34,36,43H,13,18H2,1-4H3 |
| InChIKey | GJCSLUMYDNEUTA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|