C39H32ClNO7 — CID 4616624
6-(5-chloro-2-hydroxyphenyl)-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4616624) has the molecular formula C39H32ClNO7 and a molecular weight of 662.14 g/mol. Its IUPAC name is 6-(5-chloro-2-hydroxyphenyl)-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(5-chloro-2-hydroxyphenyl)-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4616624 |
| Molecular Formula | C39H32ClNO7 |
| Molecular Weight | 662.14 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | 6-(5-chloro-2-hydroxyphenyl)-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(OC)c(C=Cc2ccc(N3C(=O)C4CC=C5C(c6cc(Cl)ccc6O)C6=C(CC5C4C3=O)C(=O)C(C)=CC6=O)cc2)c1 |
| InChI | InChI=1S/C39H32ClNO7/c1-20-16-32(43)36-30(37(20)44)19-28-26(34(36)29-18-23(40)8-14-31(29)42)12-13-27-35(28)39(46)41(38(27)45)24-9-5-21(6-10-24)4-7-22-17-25(47-2)11-15-33(22)48-3/h4-12,14-18,27-28,34-35,42H,13,19H2,1-3H3 |
| InChIKey | HNFABCKVVHXIDP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.14 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|