C39H32BrNO8 — CID 3333441
9-bromo-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3333441) has the molecular formula C39H32BrNO8 and a molecular weight of 722.59 g/mol. Its IUPAC name is 9-bromo-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3333441 |
| Molecular Formula | C39H32BrNO8 |
| Molecular Weight | 722.59 g/mol |
| Exact Mass | 721.13 |
| IUPAC Name | 9-bromo-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-5-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(OC)c(C=Cc2ccc(N3C(=O)C4CC=C5C(c6cc(OC)ccc6O)C6=C(CC5C4C3=O)C(=O)C(Br)=CC6=O)cc2)c1 |
| InChI | InChI=1S/C39H32BrNO8/c1-47-23-11-15-33(49-3)21(16-23)7-4-20-5-8-22(9-6-20)41-38(45)26-13-12-25-27(35(26)39(41)46)18-29-36(32(43)19-30(40)37(29)44)34(25)28-17-24(48-2)10-14-31(28)42/h4-12,14-17,19,26-27,34-35,42H,13,18H2,1-3H3 |
| InChIKey | URTRDOVGTPUHQL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|