C39H30Br3NO8 — CID 4150275
9-bromo-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4150275) has the molecular formula C39H30Br3NO8 and a molecular weight of 880.38 g/mol. Its IUPAC name is 9-bromo-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4150275 |
| Molecular Formula | C39H30Br3NO8 |
| Molecular Weight | 880.38 g/mol |
| Exact Mass | 876.95 |
| IUPAC Name | 9-bromo-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(OC)c(C=Cc2ccc(N3C(=O)C4CC=C5C(c6cc(OC)c(O)c(Br)c6Br)C6=C(CC5C4C3=O)C(=O)C(Br)=CC6=O)cc2)c1 |
| InChI | InChI=1S/C39H30Br3NO8/c1-49-21-10-13-29(50-2)19(14-21)7-4-18-5-8-20(9-6-18)43-38(47)23-12-11-22-24(32(23)39(43)48)15-26-33(28(44)17-27(40)36(26)45)31(22)25-16-30(51-3)37(46)35(42)34(25)41/h4-11,13-14,16-17,23-24,31-32,46H,12,15H2,1-3H3 |
| InChIKey | AVGVVNJANGSPOS-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.38 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|