C31H27NO7 — CID 6665021
(3aS,6R,11aS,11bR)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-2-phenyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6665021) has the molecular formula C31H27NO7 and a molecular weight of 525.56 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-2-phenyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-2-phenyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6665021 |
| Molecular Formula | C31H27NO7 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | (3aS,6R,11aS,11bR)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-2-phenyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)c([C@H]2C3=CC[C@@H]4C(=O)N(c5ccccc5)C(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C(C)=CC3=O)c(OC)c1 |
| InChI | InChI=1S/C31H27NO7/c1-15-11-22(33)21-14-20-18(9-10-19-25(20)31(37)32(30(19)36)16-7-5-4-6-8-16)26(27(21)29(15)35)28-23(34)12-17(38-2)13-24(28)39-3/h4-9,11-13,19-20,25-26,34H,10,14H2,1-3H3/t19-,20+,25-,26-/m0/s1 |
| InChIKey | OPGDEBWBEDIKTK-RXJAJXMTSA-N |
| XLogP | 4.04 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|