C37H38N2O7 — CID 6665038
(3aS,6R,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6665038) has the molecular formula C37H38N2O7 and a molecular weight of 622.72 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6665038 |
| Molecular Formula | C37H38N2O7 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)c([C@H]2C3=CC[C@@H]4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C(C)=CC3=O)c(OC)c1 |
| InChI | InChI=1S/C37H38N2O7/c1-20-15-28(40)27-18-26-24(32(33(27)35(20)42)34-29(41)16-23(45-2)17-30(34)46-3)9-10-25-31(26)37(44)39(36(25)43)22-11-13-38(14-12-22)19-21-7-5-4-6-8-21/h4-9,15-17,22,25-26,31-32,41H,10-14,18-19H2,1-3H3/t25-,26+,31-,32-/m0/s1 |
| InChIKey | QKRKQDTUBUMHAZ-VCOLMLNVSA-N |
| XLogP | 4.50 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|