C34H34N2O6 — CID 6666102
(3aS,6S,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6666102) has the molecular formula C34H34N2O6 and a molecular weight of 566.65 g/mol. Its IUPAC name is (3aS,6S,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6S,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6666102 |
| Molecular Formula | C34H34N2O6 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | (3aS,6S,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-[5-(hydroxymethyl)furan-2-yl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C1=O)[C@@H](c1ccc(CO)o1)C1=CC[C@@H]3C(=O)N(C4CCN(Cc5ccccc5)CC4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C34H34N2O6/c1-19-15-27(38)26-16-25-23(30(31(26)32(19)39)28-10-7-22(18-37)42-28)8-9-24-29(25)34(41)36(33(24)40)21-11-13-35(14-12-21)17-20-5-3-2-4-6-20/h2-8,10,15,21,24-25,29-30,37H,9,11-14,16-18H2,1H3/t24-,25+,29-,30+/m0/s1 |
| InChIKey | DKQLZAQGKALUMV-XLHSGLJYSA-N |
| XLogP | 3.87 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|