C39H36N2O5 — CID 6664734
(3aS,6R,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(1-hydroxynaphthalen-2-yl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6664734) has the molecular formula C39H36N2O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(1-hydroxynaphthalen-2-yl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(1-hydroxynaphthalen-2-yl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6664734 |
| Molecular Formula | C39H36N2O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-(1-benzylpiperidin-4-yl)-6-(1-hydroxynaphthalen-2-yl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CC[C@@H]4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)[C@@H]43)[C@@H]2c2ccc3ccccc3c2O)C1=O |
| InChI | InChI=1S/C39H36N2O5/c1-22-19-32(42)35-31(36(22)43)20-30-27(33(35)28-12-11-24-9-5-6-10-26(24)37(28)44)13-14-29-34(30)39(46)41(38(29)45)25-15-17-40(18-16-25)21-23-7-3-2-4-8-23/h2-13,19,25,29-30,33-34,44H,14-18,20-21H2,1H3/t29-,30+,33+,34-/m0/s1 |
| InChIKey | OUHIOARVFCATKA-KPIDMQLSSA-N |
| XLogP | 5.64 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|