C37H35Cl2N3O5 — CID 4173348
2-(1-benzylpiperidin-4-yl)-6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4173348) has the molecular formula C37H35Cl2N3O5 and a molecular weight of 672.61 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4173348 |
| Molecular Formula | C37H35Cl2N3O5 |
| Molecular Weight | 672.61 g/mol |
| Exact Mass | 671.20 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-6a,9a-dichloro-6-(1-hydroxynaphthalen-2-yl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)C43)C(c3ccc4ccccc4c3O)C2(Cl)C1=O |
| InChI | InChI=1S/C37H35Cl2N3O5/c1-40-34(46)36(38)19-28-25(30(37(36,39)35(40)47)27-12-11-22-9-5-6-10-24(22)31(27)43)13-14-26-29(28)33(45)42(32(26)44)23-15-17-41(18-16-23)20-21-7-3-2-4-8-21/h2-13,23,26,28-30,43H,14-20H2,1H3 |
| InChIKey | XAFAWEHYCHLNFK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|