C34H35Cl2N3O5 — CID 3436771
2-(1-benzylpiperidin-4-yl)-6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3436771) has the molecular formula C34H35Cl2N3O5 and a molecular weight of 636.58 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3436771 |
| Molecular Formula | C34H35Cl2N3O5 |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cc(C2C3=CCC4C(=O)N(C5CCN(Cc6ccccc6)CC5)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)ccc1O |
| InChI | InChI=1S/C34H35Cl2N3O5/c1-19-16-21(8-11-26(19)40)28-23-9-10-24-27(25(23)17-33(35)31(43)37(2)32(44)34(28,33)36)30(42)39(29(24)41)22-12-14-38(15-13-22)18-20-6-4-3-5-7-20/h3-9,11,16,22,24-25,27-28,40H,10,12-15,17-18H2,1-2H3 |
| InChIKey | DVIKIAMXSJSKGV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|