C24H22Cl2N2O7 — CID 3434489
methyl 6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 3434489) has the molecular formula C24H22Cl2N2O7 and a molecular weight of 521.35 g/mol. Its IUPAC name is methyl 6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 3434489 |
| Molecular Formula | C24H22Cl2N2O7 |
| Molecular Weight | 521.35 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | methyl 6a,9a-dichloro-6-(4-hydroxy-3-methylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(C)C(=O)C4(Cl)C3c3ccc(O)c(C)c3)C2C1=O |
| InChI | InChI=1S/C24H22Cl2N2O7/c1-10-8-11(4-7-15(10)29)17-12-5-6-13-16(19(31)28(18(13)30)22(34)35-3)14(12)9-23(25)20(32)27(2)21(33)24(17,23)26/h4-5,7-8,13-14,16-17,29H,6,9H2,1-3H3 |
| InChIKey | FVJATNLRZUMKDB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|