C23H20Cl2N2O7 — CID 3633548
methyl 6a,9a-dichloro-6-(3-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 3633548) has the molecular formula C23H20Cl2N2O7 and a molecular weight of 507.33 g/mol. Its IUPAC name is methyl 6a,9a-dichloro-6-(3-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6a,9a-dichloro-6-(3-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 3633548 |
| Molecular Formula | C23H20Cl2N2O7 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | methyl 6a,9a-dichloro-6-(3-hydroxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(C)C(=O)C4(Cl)C3c3cccc(O)c3)C2C1=O |
| InChI | InChI=1S/C23H20Cl2N2O7/c1-26-19(31)22(24)9-14-12(6-7-13-15(14)18(30)27(17(13)29)21(33)34-2)16(23(22,25)20(26)32)10-4-3-5-11(28)8-10/h3-6,8,13-16,28H,7,9H2,1-2H3 |
| InChIKey | KPODHTRUZGRYHZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|