C29H26Cl2N2O6 — CID 4989488
6a,9a-dichloro-6-(3-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethyl]-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4989488) has the molecular formula C29H26Cl2N2O6 and a molecular weight of 569.44 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(3-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethyl]-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(3-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethyl]-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4989488 |
| Molecular Formula | C29H26Cl2N2O6 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 6a,9a-dichloro-6-(3-hydroxyphenyl)-2-[2-(4-hydroxyphenyl)ethyl]-8-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(CCc5ccc(O)cc5)C(=O)C43)C(c3cccc(O)c3)C2(Cl)C1=O |
| InChI | InChI=1S/C29H26Cl2N2O6/c1-32-26(38)28(30)14-21-19(23(29(28,31)27(32)39)16-3-2-4-18(35)13-16)9-10-20-22(21)25(37)33(24(20)36)12-11-15-5-7-17(34)8-6-15/h2-9,13,20-23,34-35H,10-12,14H2,1H3 |
| InChIKey | GDPMRUUVUFYVLU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|