C24H22Cl2N2O8 — CID 6644201
methyl (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 6644201) has the molecular formula C24H22Cl2N2O8 and a molecular weight of 537.35 g/mol. Its IUPAC name is methyl (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6644201 |
| Molecular Formula | C24H22Cl2N2O8 |
| Molecular Weight | 537.35 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | methyl (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(2-hydroxy-6-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@@]2(Cl)C(=O)N(C)C(=O)[C@@]2(Cl)[C@H]3c2c(O)cccc2OC)C1=O |
| InChI | InChI=1S/C24H22Cl2N2O8/c1-27-20(32)23(25)9-12-10(7-8-11-15(12)19(31)28(18(11)30)22(34)36-3)17(24(23,26)21(27)33)16-13(29)5-4-6-14(16)35-2/h4-7,11-12,15,17,29H,8-9H2,1-3H3/t11-,12+,15-,17+,23+,24-/m0/s1 |
| InChIKey | YJDAIKNMSHWDQQ-YFRLORJKSA-N |
| XLogP | 2.16 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|