C25H24N2O10 — CID 4526236
dimethyl 6-(2-hydroxy-6-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-2,8-dicarboxylate (PubChem CID 4526236) has the molecular formula C25H24N2O10 and a molecular weight of 512.47 g/mol. Its IUPAC name is dimethyl 6-(2-hydroxy-6-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-2,8-dicarboxylate.
| Compound Name | dimethyl 6-(2-hydroxy-6-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-2,8-dicarboxylate |
|---|---|
| PubChem CID | 4526236 |
| Molecular Formula | C25H24N2O10 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | dimethyl 6-(2-hydroxy-6-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-2,8-dicarboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(C(=O)OC)C(=O)C4C3c3c(O)cccc3OC)C2C1=O |
| InChI | InChI=1S/C25H24N2O10/c1-35-15-6-4-5-14(28)19(15)17-10-7-8-11-16(22(31)26(20(11)29)24(33)36-2)12(10)9-13-18(17)23(32)27(21(13)30)25(34)37-3/h4-7,11-13,16-18,28H,8-9H2,1-3H3 |
| InChIKey | RKBDJVXQBDEQMP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|