C24H24N4O9 — CID 3702439
6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-2,8-dicarboxamide (PubChem CID 3702439) has the molecular formula C24H24N4O9 and a molecular weight of 512.48 g/mol. Its IUPAC name is 6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-2,8-dicarboxamide.
| Compound Name | 6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-2,8-dicarboxamide |
|---|---|
| PubChem CID | 3702439 |
| Molecular Formula | C24H24N4O9 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-2,8-dicarboxamide |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C(N)=O)C(=O)C4C3CC3C(=O)N(C(N)=O)C(=O)C32)cc(OC)c1O |
| InChI | InChI=1S/C24H24N4O9/c1-36-13-5-8(6-14(37-2)18(13)29)15-9-3-4-10-16(21(32)27(19(10)30)23(25)34)11(9)7-12-17(15)22(33)28(20(12)31)24(26)35/h3,5-6,10-12,15-17,29H,4,7H2,1-2H3,(H2,25,34)(H2,26,35) |
| InChIKey | SWZAPRYXNRPZFC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 199.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|