C37H31BrN2O6 — CID 6638779
(3aS,6R,6aS,9aR,10aS,10bR)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,8-bis(4-ethenylphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6638779) has the molecular formula C37H31BrN2O6 and a molecular weight of 679.57 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,8-bis(4-ethenylphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,8-bis(4-ethenylphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6638779 |
| Molecular Formula | C37H31BrN2O6 |
| Molecular Weight | 679.57 g/mol |
| Exact Mass | 678.14 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,8-bis(4-ethenylphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)[C@H]3[C@H](CC=C4[C@H]3C[C@H]3C(=O)N(c5ccc(C=C)cc5)C(=O)[C@H]3[C@H]4c3cc(Br)c(O)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C37H31BrN2O6/c1-4-19-6-10-22(11-7-19)39-34(42)25-15-14-24-26(31(25)36(39)44)18-27-32(30(24)21-16-28(38)33(41)29(17-21)46-3)37(45)40(35(27)43)23-12-8-20(5-2)9-13-23/h4-14,16-17,25-27,30-32,41H,1-2,15,18H2,3H3/t25-,26+,27+,30-,31-,32+/m0/s1 |
| InChIKey | ZPTMYRUYSORKAN-XPOONUMPSA-N |
| XLogP | 6.49 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.57 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|