C37H32N2O6 — CID 5094671
2,8-bis(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5094671) has the molecular formula C37H32N2O6 and a molecular weight of 600.67 g/mol. Its IUPAC name is 2,8-bis(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5094671 |
| Molecular Formula | C37H32N2O6 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 2,8-bis(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)C3CC=C4C(CC5C(=O)N(c6ccc(C=C)cc6)C(=O)C5C4c4ccc(O)cc4OC)C3C2=O)cc1 |
| InChI | InChI=1S/C37H32N2O6/c1-4-20-6-10-22(11-7-20)38-34(41)27-17-16-25-28(32(27)36(38)43)19-29-33(31(25)26-15-14-24(40)18-30(26)45-3)37(44)39(35(29)42)23-12-8-21(5-2)9-13-23/h4-16,18,27-29,31-33,40H,1-2,17,19H2,3H3 |
| InChIKey | KTHRCFLYQHQXQY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|