C34H28Cl2N2O7 — CID 5070985
2,8-bis(4-chlorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5070985) has the molecular formula C34H28Cl2N2O7 and a molecular weight of 647.51 g/mol. Its IUPAC name is 2,8-bis(4-chlorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(4-chlorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5070985 |
| Molecular Formula | C34H28Cl2N2O7 |
| Molecular Weight | 647.51 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | 2,8-bis(4-chlorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc(Cl)cc4)C(=O)C3C2CC2C(=O)N(c3ccc(Cl)cc3)C(=O)C21 |
| InChI | InChI=1S/C34H28Cl2N2O7/c1-44-25-13-20(39)14-26(45-2)30(25)28-21-11-12-22-27(33(42)37(31(22)40)18-7-3-16(35)4-8-18)23(21)15-24-29(28)34(43)38(32(24)41)19-9-5-17(36)6-10-19/h3-11,13-14,22-24,27-29,39H,12,15H2,1-2H3 |
| InChIKey | IQCJMHZSBXLKBK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|