C34H28N4O11 — CID 3563479
6-(4-hydroxy-2,6-dimethoxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3563479) has the molecular formula C34H28N4O11 and a molecular weight of 668.62 g/mol. Its IUPAC name is 6-(4-hydroxy-2,6-dimethoxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxy-2,6-dimethoxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3563479 |
| Molecular Formula | C34H28N4O11 |
| Molecular Weight | 668.62 g/mol |
| Exact Mass | 668.18 |
| IUPAC Name | 6-(4-hydroxy-2,6-dimethoxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C3C2CC2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C21 |
| InChI | InChI=1S/C34H28N4O11/c1-48-25-13-20(39)14-26(49-2)30(25)28-21-11-12-22-27(33(42)35(31(22)40)16-3-7-18(8-4-16)37(44)45)23(21)15-24-29(28)34(43)36(32(24)41)17-5-9-19(10-6-17)38(46)47/h3-11,13-14,22-24,27-29,39H,12,15H2,1-2H3 |
| InChIKey | IVHRGGJRSYAXSW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 199.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|