C32H24N4O9 — CID 4573940
6-(2-hydroxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4573940) has the molecular formula C32H24N4O9 and a molecular weight of 608.56 g/mol. Its IUPAC name is 6-(2-hydroxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(2-hydroxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4573940 |
| Molecular Formula | C32H24N4O9 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | 6-(2-hydroxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)C4C3c3ccccc3O)C2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H24N4O9/c37-25-4-2-1-3-21(25)26-20-13-14-22-27(31(40)33(29(22)38)16-5-9-18(10-6-16)35(42)43)23(20)15-24-28(26)32(41)34(30(24)39)17-7-11-19(12-8-17)36(44)45/h1-13,22-24,26-28,37H,14-15H2 |
| InChIKey | CHRSHGXXTWFXGU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 181.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|