C33H25BrN4O10 — CID 3702438
6-(5-bromo-2-hydroxy-3-methoxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3702438) has the molecular formula C33H25BrN4O10 and a molecular weight of 717.49 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3702438 |
| Molecular Formula | C33H25BrN4O10 |
| Molecular Weight | 717.49 g/mol |
| Exact Mass | 716.08 |
| IUPAC Name | 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-2,8-bis(4-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(Br)cc(C2C3=CCC4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)C4C3CC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C32)c1O |
| InChI | InChI=1S/C33H25BrN4O10/c1-48-25-13-15(34)12-23(29(25)39)26-20-10-11-21-27(32(42)35(30(21)40)16-2-6-18(7-3-16)37(44)45)22(20)14-24-28(26)33(43)36(31(24)41)17-4-8-19(9-5-17)38(46)47/h2-10,12-13,21-22,24,26-28,39H,11,14H2,1H3 |
| InChIKey | VBUQUHCASRRLQU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 190.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|