C33H26N4O10 — CID 3336942
6-(4-hydroxy-3-methoxyphenyl)-2,8-bis(3-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3336942) has the molecular formula C33H26N4O10 and a molecular weight of 638.59 g/mol. Its IUPAC name is 6-(4-hydroxy-3-methoxyphenyl)-2,8-bis(3-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxy-3-methoxyphenyl)-2,8-bis(3-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3336942 |
| Molecular Formula | C33H26N4O10 |
| Molecular Weight | 638.59 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | 6-(4-hydroxy-3-methoxyphenyl)-2,8-bis(3-nitrophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5cccc([N+](=O)[O-])c5)C(=O)C4C3CC3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C32)ccc1O |
| InChI | InChI=1S/C33H26N4O10/c1-47-26-12-16(8-11-25(26)38)27-21-9-10-22-28(32(41)34(30(22)39)17-4-2-6-19(13-17)36(43)44)23(21)15-24-29(27)33(42)35(31(24)40)18-5-3-7-20(14-18)37(45)46/h2-9,11-14,22-24,27-29,38H,10,15H2,1H3 |
| InChIKey | ONCIVVXMWIBRBH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 190.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|