C38H34N2O7 — CID 6638703
(3aS,6R,6aS,9aR,10aS,10bR)-2,8-bis(4-ethenylphenyl)-6-(4-hydroxy-3,5-dimethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6638703) has the molecular formula C38H34N2O7 and a molecular weight of 630.70 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-2,8-bis(4-ethenylphenyl)-6-(4-hydroxy-3,5-dimethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-2,8-bis(4-ethenylphenyl)-6-(4-hydroxy-3,5-dimethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6638703 |
| Molecular Formula | C38H34N2O7 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-2,8-bis(4-ethenylphenyl)-6-(4-hydroxy-3,5-dimethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)[C@H]3[C@H](CC=C4[C@H]3C[C@H]3C(=O)N(c5ccc(C=C)cc5)C(=O)[C@H]3[C@H]4c3cc(OC)c(O)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C38H34N2O7/c1-5-20-7-11-23(12-8-20)39-35(42)26-16-15-25-27(32(26)37(39)44)19-28-33(31(25)22-17-29(46-3)34(41)30(18-22)47-4)38(45)40(36(28)43)24-13-9-21(6-2)10-14-24/h5-15,17-18,26-28,31-33,41H,1-2,16,19H2,3-4H3/t26-,27+,28+,31-,32-,33+/m0/s1 |
| InChIKey | COAADFSAZYXQAJ-WBYCFDNHSA-N |
| XLogP | 5.74 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|