C36H32N2O7 — CID 3427083
6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2,8-diphenyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3427083) has the molecular formula C36H32N2O7 and a molecular weight of 604.66 g/mol. Its IUPAC name is 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2,8-diphenyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2,8-diphenyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3427083 |
| Molecular Formula | C36H32N2O7 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2,8-diphenyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(c5ccccc5)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C23)cc(OC)c1O |
| InChI | InChI=1S/C36H32N2O7/c1-44-28-17-20(18-29(45-2)32(28)39)13-14-24-23-15-16-25-31(36(43)37(33(25)40)21-9-5-3-6-10-21)26(23)19-27-30(24)35(42)38(34(27)41)22-11-7-4-8-12-22/h3-15,17-18,24-27,30-31,39H,16,19H2,1-2H3 |
| InChIKey | WXTDSEXDYVBJES-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|