C29H30N2O10 — CID 3542989
3-[8-(2-carboxyethyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 3542989) has the molecular formula C29H30N2O10 and a molecular weight of 566.56 g/mol. Its IUPAC name is 3-[8-(2-carboxyethyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[8-(2-carboxyethyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3542989 |
| Molecular Formula | C29H30N2O10 |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 3-[8-(2-carboxyethyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(CCC(=O)O)C(=O)C4C3CC3C(=O)N(CCC(=O)O)C(=O)C23)ccc1O |
| InChI | InChI=1S/C29H30N2O10/c1-41-21-12-14(3-7-20(21)32)2-4-16-15-5-6-17-25(29(40)30(26(17)37)10-8-22(33)34)18(15)13-19-24(16)28(39)31(27(19)38)11-9-23(35)36/h2-5,7,12,16-19,24-25,32H,6,8-11,13H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | BOSVOQLVIKPHJD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|