C33H26Cl2N2O6 — CID 5189332
2,8-bis(4-chlorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5189332) has the molecular formula C33H26Cl2N2O6 and a molecular weight of 617.49 g/mol. Its IUPAC name is 2,8-bis(4-chlorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(4-chlorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5189332 |
| Molecular Formula | C33H26Cl2N2O6 |
| Molecular Weight | 617.49 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | 2,8-bis(4-chlorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5ccc(Cl)cc5)C(=O)C4C3CC3C(=O)N(c4ccc(Cl)cc4)C(=O)C32)cc1O |
| InChI | InChI=1S/C33H26Cl2N2O6/c1-43-26-13-2-16(14-25(26)38)27-21-11-12-22-28(32(41)36(30(22)39)19-7-3-17(34)4-8-19)23(21)15-24-29(27)33(42)37(31(24)40)20-9-5-18(35)6-10-20/h2-11,13-14,22-24,27-29,38H,12,15H2,1H3 |
| InChIKey | JSLOGKDMQZEJSR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|