C36H30N2O7 — CID 4147975
2,8-bis(4-acetylphenyl)-6-(2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4147975) has the molecular formula C36H30N2O7 and a molecular weight of 602.64 g/mol. Its IUPAC name is 2,8-bis(4-acetylphenyl)-6-(2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(4-acetylphenyl)-6-(2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4147975 |
| Molecular Formula | C36H30N2O7 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 2,8-bis(4-acetylphenyl)-6-(2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC(=O)c1ccc(N2C(=O)C3CC=C4C(CC5C(=O)N(c6ccc(C(C)=O)cc6)C(=O)C5C4c4ccccc4O)C3C2=O)cc1 |
| InChI | InChI=1S/C36H30N2O7/c1-18(39)20-7-11-22(12-8-20)37-33(42)26-16-15-24-27(31(26)35(37)44)17-28-32(30(24)25-5-3-4-6-29(25)41)36(45)38(34(28)43)23-13-9-21(10-14-23)19(2)40/h3-15,26-28,30-32,41H,16-17H2,1-2H3 |
| InChIKey | QDXNLLBNFVDABZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|