C36H32N2O6 — CID 6658221
(3aS,6R,6aS,9aR,10aS,10bR)-2-(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6658221) has the molecular formula C36H32N2O6 and a molecular weight of 588.66 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-2-(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-2-(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6658221 |
| Molecular Formula | C36H32N2O6 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-2-(4-ethenylphenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)[C@H]3[C@H](CC=C4[C@H]3C[C@H]3C(=O)N(c5ccccc5)C(=O)[C@@]3(C)[C@H]4c3ccc(O)cc3OC)C2=O)cc1 |
| InChI | InChI=1S/C36H32N2O6/c1-4-20-10-12-22(13-11-20)37-32(40)26-17-16-24-27(30(26)34(37)42)19-28-33(41)38(21-8-6-5-7-9-21)35(43)36(28,2)31(24)25-15-14-23(39)18-29(25)44-3/h4-16,18,26-28,30-31,39H,1,17,19H2,2-3H3/t26-,27+,28-,30-,31+,36+/m0/s1 |
| InChIKey | NPYJENPYISFUDX-JEXHSIECSA-N |
| XLogP | 5.48 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|