C35H30N2O9 — CID 4076875
2-hydroxy-4-[6-(2-hydroxy-3-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 4076875) has the molecular formula C35H30N2O9 and a molecular weight of 622.63 g/mol. Its IUPAC name is 2-hydroxy-4-[6-(2-hydroxy-3-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 2-hydroxy-4-[6-(2-hydroxy-3-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4076875 |
| Molecular Formula | C35H30N2O9 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | 2-hydroxy-4-[6-(2-hydroxy-3-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1cccc(C2C3=CCC4C(=O)N(c5ccc(C(=O)O)c(O)c5)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)c1O |
| InChI | InChI=1S/C35H30N2O9/c1-35-24(31(41)37(34(35)45)17-7-4-3-5-8-17)16-23-19(28(35)22-9-6-10-26(46-2)29(22)39)13-14-21-27(23)32(42)36(30(21)40)18-11-12-20(33(43)44)25(38)15-18/h3-13,15,21,23-24,27-28,38-39H,14,16H2,1-2H3,(H,43,44) |
| InChIKey | JDCZPKUORSEQLS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 161.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|