C38H30N2O8 — CID 4146523
2-hydroxy-4-[6-(1-hydroxynaphthalen-2-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 4146523) has the molecular formula C38H30N2O8 and a molecular weight of 642.66 g/mol. Its IUPAC name is 2-hydroxy-4-[6-(1-hydroxynaphthalen-2-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 2-hydroxy-4-[6-(1-hydroxynaphthalen-2-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4146523 |
| Molecular Formula | C38H30N2O8 |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | 2-hydroxy-4-[6-(1-hydroxynaphthalen-2-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | CC12C(=O)N(c3ccccc3)C(=O)C1CC1C(=CCC3C(=O)N(c4ccc(C(=O)O)c(O)c4)C(=O)C31)C2c1ccc2ccccc2c1O |
| InChI | InChI=1S/C38H30N2O8/c1-38-28(34(44)40(37(38)48)20-8-3-2-4-9-20)18-27-23(31(38)26-13-11-19-7-5-6-10-22(19)32(26)42)15-16-25-30(27)35(45)39(33(25)43)21-12-14-24(36(46)47)29(41)17-21/h2-15,17,25,27-28,30-31,41-42H,16,18H2,1H3,(H,46,47) |
| InChIKey | YTJMSDXPSAHQAV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|