C42H36N2O8 — CID 4689497
2-(4-benzoylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4689497) has the molecular formula C42H36N2O8 and a molecular weight of 696.76 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-benzoylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4689497 |
| Molecular Formula | C42H36N2O8 |
| Molecular Weight | 696.76 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | 2-(4-benzoylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc(C(=O)c5ccccc5)cc4)C(=O)C3C2CC2C(=O)N(c3ccccc3)C(=O)C21C |
| InChI | InChI=1S/C42H36N2O8/c1-42-31(39(48)44(41(42)50)25-12-8-5-9-13-25)22-30-28(36(42)35-32(51-2)20-27(45)21-33(35)52-3)18-19-29-34(30)40(49)43(38(29)47)26-16-14-24(15-17-26)37(46)23-10-6-4-7-11-23/h4-18,20-21,29-31,34,36,45H,19,22H2,1-3H3 |
| InChIKey | DVNGGHUWLVCBCD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.76 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|