C40H35N3O6 — CID 4050372
2-(4-anilinophenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4050372) has the molecular formula C40H35N3O6 and a molecular weight of 653.74 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4050372 |
| Molecular Formula | C40H35N3O6 |
| Molecular Weight | 653.74 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | 2-(4-anilinophenyl)-6-(4-hydroxy-2-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCC3C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)C3C2CC2C(=O)N(c3ccccc3)C(=O)C21C |
| InChI | InChI=1S/C40H35N3O6/c1-40-32(37(46)43(39(40)48)25-11-7-4-8-12-25)22-31-28(35(40)29-18-17-27(44)21-33(29)49-2)19-20-30-34(31)38(47)42(36(30)45)26-15-13-24(14-16-26)41-23-9-5-3-6-10-23/h3-19,21,30-32,34-35,41,44H,20,22H2,1-2H3 |
| InChIKey | ZBMRTUAUBRMJLE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.74 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|