C35H31IN2O7 — CID 3660262
6-(4-hydroxy-2,6-dimethoxyphenyl)-2-(4-iodophenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3660262) has the molecular formula C35H31IN2O7 and a molecular weight of 718.54 g/mol. Its IUPAC name is 6-(4-hydroxy-2,6-dimethoxyphenyl)-2-(4-iodophenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxy-2,6-dimethoxyphenyl)-2-(4-iodophenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3660262 |
| Molecular Formula | C35H31IN2O7 |
| Molecular Weight | 718.54 g/mol |
| Exact Mass | 718.12 |
| IUPAC Name | 6-(4-hydroxy-2,6-dimethoxyphenyl)-2-(4-iodophenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc(I)cc4)C(=O)C3C2CC2C(=O)N(c3ccccc3)C(=O)C21C |
| InChI | InChI=1S/C35H31IN2O7/c1-35-25(32(41)38(34(35)43)19-7-5-4-6-8-19)17-24-22(30(35)29-26(44-2)15-21(39)16-27(29)45-3)13-14-23-28(24)33(42)37(31(23)40)20-11-9-18(36)10-12-20/h4-13,15-16,23-25,28,30,39H,14,17H2,1-3H3 |
| InChIKey | JIOLYIWQYUQPBO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|