C37H32ClFN2O8 — CID 3498320
2-(4-acetylphenyl)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3498320) has the molecular formula C37H32ClFN2O8 and a molecular weight of 687.12 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-acetylphenyl)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3498320 |
| Molecular Formula | C37H32ClFN2O8 |
| Molecular Weight | 687.12 g/mol |
| Exact Mass | 686.18 |
| IUPAC Name | 2-(4-acetylphenyl)-8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc(C(C)=O)cc4)C(=O)C3C2CC2C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C21C |
| InChI | InChI=1S/C37H32ClFN2O8/c1-17(42)18-5-7-19(8-6-18)40-33(44)23-11-10-22-24(30(23)35(40)46)16-25-34(45)41(20-9-12-27(39)26(38)13-20)36(47)37(25,2)32(22)31-28(48-3)14-21(43)15-29(31)49-4/h5-10,12-15,23-25,30,32,43H,11,16H2,1-4H3 |
| InChIKey | FECRUGDWUTZNFP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.12 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|