C34H30ClFN2O7S — CID 3685751
8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3685751) has the molecular formula C34H30ClFN2O7S and a molecular weight of 665.14 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3685751 |
| Molecular Formula | C34H30ClFN2O7S |
| Molecular Weight | 665.14 g/mol |
| Exact Mass | 664.14 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a-methyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(Cc4cccs4)C(=O)C3C2CC2C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C21C |
| InChI | InChI=1S/C34H30ClFN2O7S/c1-34-22(31(41)38(33(34)43)16-6-9-24(36)23(35)11-16)14-21-19(29(34)28-25(44-2)12-17(39)13-26(28)45-3)7-8-20-27(21)32(42)37(30(20)40)15-18-5-4-10-46-18/h4-7,9-13,20-22,27,29,39H,8,14-15H2,1-3H3 |
| InChIKey | REYZNISRJBMCME-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.14 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|