C33H30N2O6S — CID 3675368
6-(2-hydroxy-6-methoxyphenyl)-6a-methyl-8-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3675368) has the molecular formula C33H30N2O6S and a molecular weight of 582.68 g/mol. Its IUPAC name is 6-(2-hydroxy-6-methoxyphenyl)-6a-methyl-8-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(2-hydroxy-6-methoxyphenyl)-6a-methyl-8-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3675368 |
| Molecular Formula | C33H30N2O6S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 6-(2-hydroxy-6-methoxyphenyl)-6a-methyl-8-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cccc(O)c1C1C2=CCC3C(=O)N(Cc4cccs4)C(=O)C3C2CC2C(=O)N(c3ccccc3)C(=O)C21C |
| InChI | InChI=1S/C33H30N2O6S/c1-33-23(30(38)35(32(33)40)18-8-4-3-5-9-18)16-22-20(28(33)27-24(36)11-6-12-25(27)41-2)13-14-21-26(22)31(39)34(29(21)37)17-19-10-7-15-42-19/h3-13,15,21-23,26,28,36H,14,16-17H2,1-2H3 |
| InChIKey | XZRKYRJAGFRCKG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|