C33H30B2N2O10 — CID 3295971
[3-[2-(3-boronophenyl)-6-(4-hydroxy-2-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-8-yl]phenyl]boronic acid (PubChem CID 3295971) has the molecular formula C33H30B2N2O10 and a molecular weight of 636.23 g/mol. Its IUPAC name is [3-[2-(3-boronophenyl)-6-(4-hydroxy-2-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-8-yl]phenyl]boronic acid.
| Compound Name | [3-[2-(3-boronophenyl)-6-(4-hydroxy-2-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-8-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 3295971 |
| Molecular Formula | C33H30B2N2O10 |
| Molecular Weight | 636.23 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | [3-[2-(3-boronophenyl)-6-(4-hydroxy-2-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-8-yl]phenyl]boronic acid |
| SMILES | COc1cc(O)ccc1C1C2=CCC3C(=O)N(c4cccc(B(O)O)c4)C(=O)C3C2CC2C(=O)N(c3cccc(B(O)O)c3)C(=O)C21 |
| InChI | InChI=1S/C33H30B2N2O10/c1-47-26-14-20(38)8-9-22(26)27-21-10-11-23-28(32(41)36(30(23)39)18-6-2-4-16(12-18)34(43)44)24(21)15-25-29(27)33(42)37(31(25)40)19-7-3-5-17(13-19)35(45)46/h2-10,12-14,23-25,27-29,38,43-46H,11,15H2,1H3 |
| InChIKey | GILMQMBONKUEOG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 185.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|