C36H30B2N2O9 — CID 4185618
[3-[2-(3-boronophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-8-yl]phenyl]boronic acid (PubChem CID 4185618) has the molecular formula C36H30B2N2O9 and a molecular weight of 656.27 g/mol. Its IUPAC name is [3-[2-(3-boronophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-8-yl]phenyl]boronic acid.
| Compound Name | [3-[2-(3-boronophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-8-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 4185618 |
| Molecular Formula | C36H30B2N2O9 |
| Molecular Weight | 656.27 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | [3-[2-(3-boronophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-8-yl]phenyl]boronic acid |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cccc(B(O)O)c5)C(=O)C4C3c3ccc(O)c4ccccc34)C2C(=O)N1c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C36H30B2N2O9/c41-29-14-13-24(22-9-1-2-10-23(22)29)30-25-11-12-26-31(35(44)39(33(26)42)20-7-3-5-18(15-20)37(46)47)27(25)17-28-32(30)36(45)40(34(28)43)21-8-4-6-19(16-21)38(48)49/h1-11,13-16,26-28,30-32,41,46-49H,12,17H2 |
| InChIKey | XERKAJBOLBIOJS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 175.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|