C36H26BCl2FN2O7 — CID 5059296
[3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 5059296) has the molecular formula C36H26BCl2FN2O7 and a molecular weight of 699.33 g/mol. Its IUPAC name is [3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 5059296 |
| Molecular Formula | C36H26BCl2FN2O7 |
| Molecular Weight | 699.33 g/mol |
| Exact Mass | 698.12 |
| IUPAC Name | [3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3ccc(O)c4ccccc34)C2C(=O)N1c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C36H26BCl2FN2O7/c38-35-17-27-25(12-13-26-29(27)32(45)41(31(26)44)21-5-3-4-18(16-21)37(48)49)30(24-14-15-28(43)23-7-2-1-6-22(23)24)36(35,39)34(47)42(33(35)46)20-10-8-19(40)9-11-20/h1-12,14-16,26-27,29-30,43,48-49H,13,17H2 |
| InChIKey | PZGZHNHENNACSF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|