C34H27Cl2FN2O7 — CID 4536522
4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 4536522) has the molecular formula C34H27Cl2FN2O7 and a molecular weight of 665.50 g/mol. Its IUPAC name is 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 4536522 |
| Molecular Formula | C34H27Cl2FN2O7 |
| Molecular Weight | 665.50 g/mol |
| Exact Mass | 664.12 |
| IUPAC Name | 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxynaphthalen-1-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3ccc(O)c4ccccc34)C2C1=O |
| InChI | InChI=1S/C34H27Cl2FN2O7/c35-33-16-24-22(11-12-23-27(24)30(44)38(29(23)43)15-3-6-26(41)42)28(21-13-14-25(40)20-5-2-1-4-19(20)21)34(33,36)32(46)39(31(33)45)18-9-7-17(37)8-10-18/h1-2,4-5,7-11,13-14,23-24,27-28,40H,3,6,12,15-16H2,(H,41,42) |
| InChIKey | PYSDRMMZPACYMF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|