C32H29Cl2FN2O9 — CID 4572703
4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 4572703) has the molecular formula C32H29Cl2FN2O9 and a molecular weight of 675.49 g/mol. Its IUPAC name is 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 4572703 |
| Molecular Formula | C32H29Cl2FN2O9 |
| Molecular Weight | 675.49 g/mol |
| Exact Mass | 674.12 |
| IUPAC Name | 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(CCCC(=O)O)C(=O)C3C2CC2(Cl)C(=O)N(c3ccc(F)cc3)C(=O)C12Cl |
| InChI | InChI=1S/C32H29Cl2FN2O9/c1-45-21-12-17(38)13-22(46-2)25(21)26-18-9-10-19-24(28(42)36(27(19)41)11-3-4-23(39)40)20(18)14-31(33)29(43)37(30(44)32(26,31)34)16-7-5-15(35)6-8-16/h5-9,12-13,19-20,24,26,38H,3-4,10-11,14H2,1-2H3,(H,39,40) |
| InChIKey | MYHNMNDVWFOJDC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|