C40H32Cl2FN3O7 — CID 5239665
2-(4-anilinophenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5239665) has the molecular formula C40H32Cl2FN3O7 and a molecular weight of 756.61 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5239665 |
| Molecular Formula | C40H32Cl2FN3O7 |
| Molecular Weight | 756.61 g/mol |
| Exact Mass | 755.16 |
| IUPAC Name | 2-(4-anilinophenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)C3C2CC2(Cl)C(=O)N(c3ccc(F)cc3)C(=O)C12Cl |
| InChI | InChI=1S/C40H32Cl2FN3O7/c1-52-30-18-26(47)19-31(53-2)33(30)34-27-16-17-28-32(36(49)45(35(28)48)24-14-10-23(11-15-24)44-22-6-4-3-5-7-22)29(27)20-39(41)37(50)46(38(51)40(34,39)42)25-12-8-21(43)9-13-25/h3-16,18-19,28-29,32,34,44,47H,17,20H2,1-2H3 |
| InChIKey | SGMMSPQQRMXUAF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|